Products 1261674-69-4

CAS 1261674-69-4 appears in our catalog under these names: 2-Bromo-6-methoxybenzenesulfonyl chloride, 96%, 96%, 2-Bromo-6-methoxybenzenesulfonyl chloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 10g.

Structural formula: {0} (CAS {1})

2-bromo-6-methoxybenzenesulfonyl chloride (CAS 1261674-69-4) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 2-bromo-6-methoxybenzenesulfonyl chloride. InChIKey: SVJDLWOYMXELNX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrClO3S
Molecular weight285.54 g/mol
IUPAC name2-bromo-6-methoxybenzenesulfonyl chloride
InChIKeySVJDLWOYMXELNX-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)