CAS 1261674-69-4 appears in our catalog under these names: 2-Bromo-6-methoxybenzenesulfonyl chloride, 96%, 96%, 2-Bromo-6-methoxybenzenesulfonyl chloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 10g.
2-bromo-6-methoxybenzenesulfonyl chloride (CAS 1261674-69-4) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 2-bromo-6-methoxybenzenesulfonyl chloride. InChIKey: SVJDLWOYMXELNX-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 2-bromo-6-methoxybenzenesulfonyl chloride |
| InChIKey | SVJDLWOYMXELNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)