2-Bromo-5-(tert-butyl)isophthalic acid, 97%
cas: 64395-03-5 — see every product listed under this CAS number, including other names
2-Bromo-5-(tert-butyl)isophthalic acid, 97% (CAS 64395-03-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A583470-250mg |
| cas | 64395-03-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1366.06 Pln | |
| Ambeed | 1g | 3930.38 Pln | |
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 2819.60 Pln | |
| BLDpharm | 50mg | 447.64 Pln | |
| BLDpharm | 100mg | 719.77 Pln | |
| BLDpharm | 250mg | 1358.44 Pln | |
| BLDpharm | 1g | 3940.86 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-5-tert-butylbenzene-1,3-dicarboxylic acid (CAS 64395-03-5) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: 2-bromo-5-tert-butylbenzene-1,3-dicarboxylic acid. InChIKey: OZAYOMJBHRYFOQ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 2-bromo-5-tert-butylbenzene-1,3-dicarboxylic acid |
| InChIKey | OZAYOMJBHRYFOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(=O)O)Br)C(=O)O |
Computed by PubChem (NCBI)