Products 64395-03-5
CAS 64395-03-5 appears in our catalog under these names: 2-Bromo-5-(tert-butyl)isophthalic acid, 97%, 97%, 2-Bromo-5-(tert-butyl)isophthalic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-bromo-5-tert-butylbenzene-1,3-dicarboxylic acid (CAS 64395-03-5) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: 2-bromo-5-tert-butylbenzene-1,3-dicarboxylic acid. InChIKey: OZAYOMJBHRYFOQ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 2-bromo-5-tert-butylbenzene-1,3-dicarboxylic acid |
| InChIKey | OZAYOMJBHRYFOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(=O)O)Br)C(=O)O |
Computed by PubChem (NCBI)