CAS 21739-93-5 appears in our catalog under these names: 2–Bromo–5–chlorobenzoic Acid, 2-Bromo-5-chlorobenzoic acid, 98+% , 2-BROMO-5-CHLOROBENZOIC ACID, 96%, 2-Bromo-5-chlorobenzoic acid, 98%, 2-Bromo-5-chlorobenzoic Acid, >98.0%(GC)(T). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem, TCI. Available pack sizes: 100g, 500g, 1g, 5g, 25g, 10g.
2-bromo-5-chlorobenzoic acid (CAS 21739-93-5) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 2-bromo-5-chlorobenzoic acid. InChIKey: RBCPJQQJBAQSOU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 2-bromo-5-chlorobenzoic acid |
| InChIKey | RBCPJQQJBAQSOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)Br |
Computed by PubChem (NCBI)