cas: 823-73-4 — see every product listed under this CAS number, including other names
2-Bromo-5-nitrofuran 98% (CAS 823-73-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A860206-100mg |
| cas | 823-73-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A860206 |
2-bromo-5-nitrofuran (CAS 823-73-4) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 2-bromo-5-nitrofuran. InChIKey: QGTDMAKRJHGXOF-UHFFFAOYSA-N.
| Molecular formula | C4H2BrNO3 |
|---|---|
| Molecular weight | 191.97 g/mol |
| IUPAC name | 2-bromo-5-nitrofuran |
| InChIKey | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)