cas: 823-73-4 — see every product listed under this CAS number, including other names
2-Bromo-5-nitrofuran, 98% (CAS 823-73-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720622-100MG |
| cas | 823-73-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1320.39 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-nitrofuran (CAS 823-73-4) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 2-bromo-5-nitrofuran. InChIKey: QGTDMAKRJHGXOF-UHFFFAOYSA-N.
| Molecular formula | C4H2BrNO3 |
|---|---|
| Molecular weight | 191.97 g/mol |
| IUPAC name | 2-bromo-5-nitrofuran |
| InChIKey | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)