cas: 823-73-4 — see every product listed under this CAS number, including other names
2-Bromo-5-nitrofuran, >98.0%(GC) (CAS 823-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1470-1G |
| cas | 823-73-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 442.88 Pln | |
| TCI | 5g | 1426.33 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-bromo-5-nitrofuran (CAS 823-73-4) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 2-bromo-5-nitrofuran. InChIKey: QGTDMAKRJHGXOF-UHFFFAOYSA-N.
| Molecular formula | C4H2BrNO3 |
|---|---|
| Molecular weight | 191.97 g/mol |
| IUPAC name | 2-bromo-5-nitrofuran |
| InChIKey | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)