cas: 107351-82-6 — see every product listed under this CAS number, including other names
2-Bromo-5-phenylpyridine, 97% (CAS 107351-82-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079671-250MG |
| cas | 107351-82-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 575.86 Pln | |
| Fluorochem | 10g | 1096.51 Pln | |
| Fluorochem | 25g | 2476.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-phenylpyridine (CAS 107351-82-6) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-5-phenylpyridine. InChIKey: TVOAXRDXTGCPBB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-5-phenylpyridine |
| InChIKey | TVOAXRDXTGCPBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)