CAS 142137-17-5 appears in our catalog under these names: 3-Bromo-5-phenylpyridine, 97%, 3-Bromo-5-phenylpyridine 98%, 3-Bromo-5-phenylpyridine, 98%, 3-BROMO-5-PHENYLPYRIDINE, 98%, 98%, 3-Bromo-5-phenylpyridine, >98.0%(GC)(T). Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat, TCI. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100g, 100mg, 200mg.
3-bromo-5-phenylpyridine (CAS 142137-17-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-bromo-5-phenylpyridine. InChIKey: AWCQJXPOCRXHNK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-bromo-5-phenylpyridine |
| InChIKey | AWCQJXPOCRXHNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)