CAS 98420-98-5 appears in our catalog under these names: 4-Bromo-2-phenylpyridine, 95%, 4-Bromo-2-phenylpyridine 95%, 4-Bromo-2-phenylpyridine, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-bromo-2-phenylpyridine (CAS 98420-98-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 4-bromo-2-phenylpyridine. InChIKey: HCQHVQSQHXZRGA-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 4-bromo-2-phenylpyridine |
| InChIKey | HCQHVQSQHXZRGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)