CAS 440112-20-9 appears in our catalog under these names: 4-Bromo-3-phenylpyridine, 95%, 4-Bromo-3-phenylpyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-bromo-3-phenylpyridine (CAS 440112-20-9) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 4-bromo-3-phenylpyridine. InChIKey: PJQXGXWAGCCGKK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 4-bromo-3-phenylpyridine |
| InChIKey | PJQXGXWAGCCGKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CN=C2)Br |
Computed by PubChem (NCBI)