CAS 91182-50-2 appears in our catalog under these names: 3–Bromo–2–phenylpyridine, 3-Bromo-2-phenylpyridine, 97%, 3-Bromo-2-phenylpyridine 97%, 3-Bromo-2-phenylpyridine, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 100mg.
3-bromo-2-phenylpyridine (CAS 91182-50-2) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-bromo-2-phenylpyridine. InChIKey: QODMOFYNGFSWSQ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-bromo-2-phenylpyridine |
| InChIKey | QODMOFYNGFSWSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)Br |
Computed by PubChem (NCBI)