CAS 107351-82-6 appears in our catalog under these names: 2-Bromo-5-phenylpyridine, 95%, 2-Bromo-5-phenylpyridine 97%, 2-Bromo-5-phenylpyridine, 97%, 97%, 2-Bromo-5-phenylpyridine, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-bromo-5-phenylpyridine (CAS 107351-82-6) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-5-phenylpyridine. InChIKey: TVOAXRDXTGCPBB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-5-phenylpyridine |
| InChIKey | TVOAXRDXTGCPBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)