cas: 1192263-89-0 — see every product listed under this CAS number, including other names
2-Bromo-6-(trifluoromethyl)nicotinaldehyde, 95%, 95% (CAS 1192263-89-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IEC-10g |
| cas | 1192263-89-0 |
| size | 10g |
| availability | 16g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-(trifluoromethyl)pyridine-3-carbaldehyde (CAS 1192263-89-0) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)pyridine-3-carbaldehyde. InChIKey: ASPYNUKRQBNFIT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)pyridine-3-carbaldehyde |
| InChIKey | ASPYNUKRQBNFIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C=O)Br)C(F)(F)F |
Computed by PubChem (NCBI)