CAS 1506289-36-6 is the registry number for 3-Bromo-2,5,6-trifluorobenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-2,5,6-trifluorobenzamide (CAS 1506289-36-6) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 3-bromo-2,5,6-trifluorobenzamide. InChIKey: YFHBVEKSGNRTTF-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 3-bromo-2,5,6-trifluorobenzamide |
| InChIKey | YFHBVEKSGNRTTF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)C(=O)N)F)F |
Computed by PubChem (NCBI)