CAS 886364-47-2 appears in our catalog under these names: 1-(6-Bromopyridin-3-yl)-2,2,2-trifluoroethanone, 1-(6-BROMOPYRIDIN-3-YL)-2,2,2-TRIFLUOROETHAN-1-ONE, 98%(GC-MS),RG, 98%(GC-MS),RG, 1-(6-Bromopyridin-3-yl)-2,2,2-trifluoroethan-1-one, 98%(GC-MS),RG. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
1-(6-bromo-3-pyridinyl)-2,2,2-trifluoroethanone (CAS 886364-47-2) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 1-(6-bromo-3-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: ZZWPCTJVPNGEHU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 1-(6-bromo-3-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | ZZWPCTJVPNGEHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)