Products 886364-57-4
CAS 886364-57-4 is the registry number for 1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanone (CAS 886364-57-4) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: IRHXXHPAPZNQEM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | IRHXXHPAPZNQEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)