cas: 1020718-20-0 — see every product listed under this CAS number, including other names
2-Bromo-6-fluorobenzoyl chloride, 95% (CAS 1020718-20-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QI-0484-10g |
| cas | 1020718-20-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 25g | 1726.49 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-bromo-6-fluorobenzoyl chloride (CAS 1020718-20-0) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-6-fluorobenzoyl chloride. InChIKey: ZQOQNOOLDFFUDH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-6-fluorobenzoyl chloride |
| InChIKey | ZQOQNOOLDFFUDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)Cl)F |
Computed by PubChem (NCBI)