2-Bromo-6-nitro benzaldehyde, 98%, 98%
cas: 20357-21-5 — see every product listed under this CAS number, including other names
2-Bromo-6-nitro benzaldehyde, 98%, 98% (CAS 20357-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1139ZQ-100mg |
| cas | 20357-21-5 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 100g | 2819.60 Pln | |
| Chemat | 500g | 8246.40 Pln | |
| Chemat | 50g | 1442.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-nitrobenzaldehyde (CAS 20357-21-5) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 2-bromo-6-nitrobenzaldehyde. InChIKey: WRIAMYXQKSDDRP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 2-bromo-6-nitrobenzaldehyde |
| InChIKey | WRIAMYXQKSDDRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)