cas: 59337-92-7 — see every product listed under this CAS number, including other names
2-Carbomethoxy-3-thiophenesulfonyl chloride, 95% (CAS 59337-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 398610010 |
| cas | 59337-92-7 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 102.01 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Methyl 3-chlorosulfonylthiophene-2-carboxylate (CAS 59337-92-7) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: methyl 3-chlorosulfonylthiophene-2-carboxylate. InChIKey: PJVJBDAUWILEOG-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO4S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | methyl 3-chlorosulfonylthiophene-2-carboxylate |
| InChIKey | PJVJBDAUWILEOG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)