cas: 59337-92-7 — see every product listed under this CAS number, including other names
Methyl 3-(chlorosulfonyl)thiophene-2-carboxylate, 97%, 97% (CAS 59337-92-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RRX-5g |
| cas | 59337-92-7 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 150.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-chlorosulfonylthiophene-2-carboxylate (CAS 59337-92-7) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: methyl 3-chlorosulfonylthiophene-2-carboxylate. InChIKey: PJVJBDAUWILEOG-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO4S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | methyl 3-chlorosulfonylthiophene-2-carboxylate |
| InChIKey | PJVJBDAUWILEOG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)