2-Chloro-3-(trifluoromethyl)phenylboronic acid, 97%
cas: 957061-11-9 — see every product listed under this CAS number, including other names
2-Chloro-3-(trifluoromethyl)phenylboronic acid, 97% (CAS 957061-11-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A243122-250mg |
| cas | 957061-11-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 50g | 856.40 Pln | |
| Chemat | 100g | 1610.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-chloro-3-(trifluoromethyl)phenyl]boronic acid (CAS 957061-11-9) is a chemical compound with the molecular formula C7H5BClF3O2 and a molecular weight of 224.37 g/mol. IUPAC name: [2-chloro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: NEHJDQKHVZYUAA-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O2 |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | [2-chloro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NEHJDQKHVZYUAA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)