Products 957061-11-9

CAS 957061-11-9 appears in our catalog under these names: 2-Chloro-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), 2-Chloro-3-(trifluoromethyl)phenylboronic acid 97%, 2-Chloro-3-(trifluoromethyl)phenylboronic acid 98+%, 2-Chloro-3-(trifluoromethyl)phenylboronic acid, 97%, 97%, 2-Chloro-3-(trifluoromethyl)phenylboronic acid, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 250mg, 5g, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

[2-chloro-3-(trifluoromethyl)phenyl]boronic acid (CAS 957061-11-9) is a chemical compound with the molecular formula C7H5BClF3O2 and a molecular weight of 224.37 g/mol. IUPAC name: [2-chloro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: NEHJDQKHVZYUAA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BClF3O2
Molecular weight224.37 g/mol
IUPAC name[2-chloro-3-(trifluoromethyl)phenyl]boronic acid
InChIKeyNEHJDQKHVZYUAA-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)C(F)(F)F)Cl)(O)O

Computed by PubChem (NCBI)