CAS 182344-18-9 appears in our catalog under these names: 2–Chloro–5–(trifluoromethyl)benzeneboronic acid, 2-Chloro-5-(trifluoromethyl)benzeneboronic acid, 96% , 2-Chloro-5-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), 2-Chloro-5-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride) 97%, 2-Chloro-5-(trifluoromethyl)phenylboronic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
[2-chloro-5-(trifluoromethyl)phenyl]boronic acid (CAS 182344-18-9) is a chemical compound with the molecular formula C7H5BClF3O2 and a molecular weight of 224.37 g/mol. IUPAC name: [2-chloro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: YVMXEHZEYONARR-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O2 |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YVMXEHZEYONARR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)