CAS 313545-41-4 appears in our catalog under these names: 4–Chloro–2–(trifluoromethyl)benzeneboronic acid, 4-Chloro-2-(trifluoromethyl)benzeneboronic acid, 97% , 4-Chloro-2-(trifluoromethyl)phenylboronic acid 97%, 4-Chloro-2-(trifluoromethyl)phenylboronic acid, 97%, 4-Chloro-2-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 250mg.
[4-chloro-2-(trifluoromethyl)phenyl]boronic acid (CAS 313545-41-4) is a chemical compound with the molecular formula C7H5BClF3O2 and a molecular weight of 224.37 g/mol. IUPAC name: [4-chloro-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: YAPBOBGBYQQYHX-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O2 |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | [4-chloro-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YAPBOBGBYQQYHX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)