CAS 847756-88-1 appears in our catalog under these names: 3–Chloro–4–(Trifluoromethyl)Phenylboronic Acid, 3-Chloro-4-(trifluoromethyl)benzeneboronic acid, 97% , 3-Chloro-4-(trifluoromethyl)phenylboronic acid 97%, 3-Chloro-4-(trifluoromethyl)phenylboronic acid, 97%, 97%, 3-Chloro-4-(trifluoromethyl)phenylboronic acid, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS 847756-88-1) is a chemical compound with the molecular formula C7H5BClF3O2 and a molecular weight of 224.37 g/mol. IUPAC name: [3-chloro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: OCHKTAGGJMWISO-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O2 |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | [3-chloro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | OCHKTAGGJMWISO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)