CAS 851756-52-0 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)phenylboronic acid 97%, 2-Chloro-6-(Trifluoromethyl)Phenylboronic Acid, 98%, 98%, 2-Chloro-6-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g.
[2-chloro-6-(trifluoromethyl)phenyl]boronic acid (CAS 851756-52-0) is a chemical compound with the molecular formula C7H5BClF3O2 and a molecular weight of 224.37 g/mol. IUPAC name: [2-chloro-6-(trifluoromethyl)phenyl]boronic acid. InChIKey: ARGDVPMTQZNUBG-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O2 |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | [2-chloro-6-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ARGDVPMTQZNUBG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)