cas: 18093-05-5 — see every product listed under this CAS number, including other names
2-Chloro-4,5-dimethoxybenzaldehyde, ≥97%, ≥97% (CAS 18093-05-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1133HT-50mg |
| cas | 18093-05-5 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 2032.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4,5-dimethoxybenzaldehyde (CAS 18093-05-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-4,5-dimethoxybenzaldehyde. InChIKey: KTLBJNXLHDMIRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-4,5-dimethoxybenzaldehyde |
| InChIKey | KTLBJNXLHDMIRZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Cl)OC |
Computed by PubChem (NCBI)