CAS 15196-83-5 appears in our catalog under these names: Ethyl 5-chloro-2-hydroxybenzoate, 95+%, 5-Chloro-2-hydroxybenzoic acid ethyl ester, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 5-chloro-2-hydroxybenzoate (CAS 15196-83-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: ethyl 5-chloro-2-hydroxybenzoate. InChIKey: ATMSMRINTOGATK-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | ethyl 5-chloro-2-hydroxybenzoate |
| InChIKey | ATMSMRINTOGATK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)