cas: 3913-17-5 — see every product listed under this CAS number, including other names
2-Chloro-4,8-dimethylquinoline, 98%, 98% (CAS 3913-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187HY-100mg |
| cas | 3913-17-5 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 25g | 1298.00 Pln | |
| Chemat | 10g | 669.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4,8-dimethylquinoline (CAS 3913-17-5) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-4,8-dimethylquinoline. InChIKey: UAKXMKQZURGJKF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-4,8-dimethylquinoline |
| InChIKey | UAKXMKQZURGJKF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)Cl)C |
Computed by PubChem (NCBI)