cas: 83726-75-4 — see every product listed under this CAS number, including other names
2-Chloro-4-(thiophen-2-yl)pyrimidine, ≥97-<99% (CAS 83726-75-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1836-97-99-5g |
| cas | 83726-75-4 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 5801.18 Pln | |
| Hoffman Fine Chemicals | 10g | 9093.26 Pln | |
| Hoffman Fine Chemicals | 25g | 17865.76 Pln | |
| Hoffman Fine Chemicals | 50g | 28405.52 Pln | |
| Hoffman Fine Chemicals | 100g | 45267.86 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-chloro-4-thiophen-2-ylpyrimidine (CAS 83726-75-4) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 2-chloro-4-thiophen-2-ylpyrimidine. InChIKey: DTDHCBGOLGIIOA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 2-chloro-4-thiophen-2-ylpyrimidine |
| InChIKey | DTDHCBGOLGIIOA-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)