CAS 2639539-20-9 is the registry number for 7-Chloro-1,6-naphthyridine-2(1H)-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1H-1,6-naphthyridine-2-thione (CAS 2639539-20-9) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 7-chloro-1H-1,6-naphthyridine-2-thione. InChIKey: ZZDATCZANVTWNW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 7-chloro-1H-1,6-naphthyridine-2-thione |
| InChIKey | ZZDATCZANVTWNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)NC2=CC(=NC=C21)Cl |
Computed by PubChem (NCBI)