CAS 24255-23-0 appears in our catalog under these names: 5-Chloro-3-phenyl-1,2,4-thiadiazole, 95%, 5-Chloro-3-phenyl-(1,2,4)thiadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
5-chloro-3-phenyl-1,2,4-thiadiazole (CAS 24255-23-0) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 5-chloro-3-phenyl-1,2,4-thiadiazole. InChIKey: FJDVOZDQWUMILL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,2,4-thiadiazole |
| InChIKey | FJDVOZDQWUMILL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)Cl |
Computed by PubChem (NCBI)