CAS 13373-11-0 appears in our catalog under these names: 2-Chloro-5-phenyl-1,3,4-thiadiazole, 95%, 2-Chloro-5-phenyl-1,3,4-thiadiazole 97%, 2-chloro-5-phenyl-1,3,4-thiadiazole, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-5-phenyl-1,3,4-thiadiazole (CAS 13373-11-0) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 2-chloro-5-phenyl-1,3,4-thiadiazole. InChIKey: ASSPGHHANNDMET-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 2-chloro-5-phenyl-1,3,4-thiadiazole |
| InChIKey | ASSPGHHANNDMET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)Cl |
Computed by PubChem (NCBI)