CAS 53646-00-7 is the registry number for 5-Chloro-4-phenyl-1,2,3-thiadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-chloro-4-phenylthiadiazole (CAS 53646-00-7) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 5-chloro-4-phenylthiadiazole. InChIKey: SQCPDDVZJOHPAZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 5-chloro-4-phenylthiadiazole |
| InChIKey | SQCPDDVZJOHPAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SN=N2)Cl |
Computed by PubChem (NCBI)