CAS 101495-56-1 is the registry number for 3-Chloro-5-phenyl-1,2,4-thiadiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5-phenyl-1,2,4-thiadiazole (CAS 101495-56-1) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 3-chloro-5-phenyl-1,2,4-thiadiazole. InChIKey: ZGROIHXQCKYCPT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 3-chloro-5-phenyl-1,2,4-thiadiazole |
| InChIKey | ZGROIHXQCKYCPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NS2)Cl |
Computed by PubChem (NCBI)