cas: 590371-81-6 — see every product listed under this CAS number, including other names
2-Chloro-4-(trifluoromethyl)nicotinic acid, 98% (CAS 590371-81-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043627-1G |
| cas | 590371-81-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 1018.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-4-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 590371-81-6) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: FZIJHEOXLKCIRZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | FZIJHEOXLKCIRZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(F)(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)