CAS 401-93-4 appears in our catalog under these names: 1–Chloro–3–nitro–5–(trifluoromethyl)benzene, 1-Chloro-3-nitro-5-(trifluoromethyl)benzene 95% GC, 1-Chloro-3-nitro-5-trifluoromethyl-benzene, 96%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
1-chloro-3-nitro-5-(trifluoromethyl)benzene (CAS 401-93-4) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 1-chloro-3-nitro-5-(trifluoromethyl)benzene. InChIKey: ZQXCQTAELHSNAT-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 1-chloro-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | ZQXCQTAELHSNAT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Cl)C(F)(F)F |
Computed by PubChem (NCBI)