CAS 1227587-24-7 appears in our catalog under these names: 2-Chloro-3-(trifluoromethyl)isonicotinic acid, 95%, 2-Chloro-3-(trifluoromethyl)isonicotinic acid, 97%, 4-Pyridinecarboxylic acid, 2-chloro-3-(trifluoromethyl)-, 97%, 97%, 2-Chloro-3-(trifluoromethyl)isonicotinic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 500mg.
2-chloro-3-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1227587-24-7) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-3-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: DIPOFUPESWIQSO-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | DIPOFUPESWIQSO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)