CAS 1060810-66-3 appears in our catalog under these names: 4-Chloro-6-(trifluoromethyl)nicotinic acid, 98%, 4-Chloro-6-(trifluoromethyl)-3-pyridinecarboxylic Acid, >95% (HPLC), 4-chloro-6-(trifluoromethyl)nicotinic acid, 98%, 98%, 4-CHLORO-6-(TRIFLUOROMETHYL)PYRIDINE-3-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
4-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1060810-66-3) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 4-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: CIGVUOHSGVRSIC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 4-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | CIGVUOHSGVRSIC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)