Products 796090-31-8
CAS 796090-31-8 appears in our catalog under these names: 5-Chloro-4-(trifluoromethyl)pyridine-2-carboxylic acid, 95%, 5-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 100mg, 250mg, 500mg.
5-chloro-4-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 796090-31-8) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: ZUECDOBROYTMSJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | ZUECDOBROYTMSJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(=O)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)