CAS 796090-23-8 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)isonicotinic acid, 95%, 2–Chloro–6–(trifluoromethyl)isonicotinic acid, 2-Chloro-6-(trifluoromethyl)isonicotinic acid 96%, 2-Chloro-6-(trifluoromethyl)isonicotinic Acid, 96%, 96%, 2-Chloro-6-(trifluoromethyl)isonicotinic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 100g, 25g, 10g.
2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 796090-23-8) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: OMXMPMNUSMLQQS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | OMXMPMNUSMLQQS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)