cas: 1214386-29-4 — see every product listed under this CAS number, including other names
2-Chloro-4-bromo-5-fluorobenzaldehyde, 97% (CAS 1214386-29-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237427-250MG |
| cas | 1214386-29-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 10g | 732.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-chloro-5-fluorobenzaldehyde (CAS 1214386-29-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-chloro-5-fluorobenzaldehyde. InChIKey: XPEGZWLIWARWAA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-fluorobenzaldehyde |
| InChIKey | XPEGZWLIWARWAA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)Cl)C=O |
Computed by PubChem (NCBI)