2-Chloro-4-fluoro-5-nitrobenzaldehyde, 98%
cas: 99329-85-8 — see every product listed under this CAS number, including other names
2-Chloro-4-fluoro-5-nitrobenzaldehyde, 98% (CAS 99329-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch116SQI-100mg |
| cas | 99329-85-8 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 100g | 818.00 Pln | |
| Chemat | 250g | 1715.60 Pln | |
| Chemat | 500g | 3235.20 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 945.52 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-fluoro-5-nitrobenzaldehyde (CAS 99329-85-8) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 2-chloro-4-fluoro-5-nitrobenzaldehyde. InChIKey: HNOIAPRHNXBCAE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 2-chloro-4-fluoro-5-nitrobenzaldehyde |
| InChIKey | HNOIAPRHNXBCAE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)Cl)C=O |
Computed by PubChem (NCBI)