CAS 403-23-6 is the registry number for 2-Fluoro-4-nitrobenzoyl chloride, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-fluoro-4-nitrobenzoyl chloride (CAS 403-23-6) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 2-fluoro-4-nitrobenzoyl chloride. InChIKey: BUBMAUUSVWQBMS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 2-fluoro-4-nitrobenzoyl chloride |
| InChIKey | BUBMAUUSVWQBMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)C(=O)Cl |
Computed by PubChem (NCBI)