CAS 213382-47-9 is the registry number for 5-Chloro-4-fluoro-2-nitrobenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
5-chloro-4-fluoro-2-nitrobenzaldehyde (CAS 213382-47-9) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 5-chloro-4-fluoro-2-nitrobenzaldehyde. InChIKey: JXZQEXAZVGYZDQ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-nitrobenzaldehyde |
| InChIKey | JXZQEXAZVGYZDQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)