cas: 94444-58-3 — see every product listed under this CAS number, including other names
2-Chloro-4-fluorobenzotrifluoride 98% (CAS 94444-58-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A777657-1g |
| cas | 94444-58-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1193.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A777657 |
2-chloro-4-fluoro-1-(trifluoromethyl)benzene (CAS 94444-58-3) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 2-chloro-4-fluoro-1-(trifluoromethyl)benzene. InChIKey: UHHZGIHGBLCIJM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 2-chloro-4-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | UHHZGIHGBLCIJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)