CAS 21622-18-4 is the registry number for 2,3,4,5-Tetrafluorobenzyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(chloromethyl)-2,3,4,5-tetrafluorobenzene (CAS 21622-18-4) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 1-(chloromethyl)-2,3,4,5-tetrafluorobenzene. InChIKey: PVSKKLFYHHQKFR-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 1-(chloromethyl)-2,3,4,5-tetrafluorobenzene |
| InChIKey | PVSKKLFYHHQKFR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)CCl |
Computed by PubChem (NCBI)