CAS 1214326-75-6 is the registry number for 1-Chloro-4-(difluoromethyl)-2,5-difluorobenzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-4-(difluoromethyl)-2,5-difluorobenzene (CAS 1214326-75-6) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 1-chloro-4-(difluoromethyl)-2,5-difluorobenzene. InChIKey: DPFPLHYYYCDADN-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 1-chloro-4-(difluoromethyl)-2,5-difluorobenzene |
| InChIKey | DPFPLHYYYCDADN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)F)C(F)F |
Computed by PubChem (NCBI)