CAS 60903-82-4 is the registry number for 4-Chloro-2,3,5,6-tetrafluorotoluene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene (CAS 60903-82-4) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene. InChIKey: PEVAKFLYJORONK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene |
| InChIKey | PEVAKFLYJORONK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)Cl)F)F |
Computed by PubChem (NCBI)